| Preferred Name |
C21-steroid |
| Synonyms |
a C21-steroid |
| Definitions |
A steroid that has a structure based on a 21-carbon (pregnane) skeleton. Note that individual examples may have ring substituents at other positions and/or contain double bonds, aromatic A-rings, expanded/contracted rings etc., so the formula and mass may vary from that given for the generic structure. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_61313 |
| charge |
0 |
| formula |
C21H36 |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
a C21-steroid |
| id |
CHEBI:61313 |
| imported from | |
| in subset | |
| inchi |
InChI=1S/C21H36/c1-4-15-9-11-18-17-10-8-16-7-5-6-13-20(16,2)19(17)12-14-21(15,18)3/h15-19H,4-14H2,1-3H3 |
| inchikey |
JWMFYGXQPXQEEM-UHFFFAOYSA-N |
| label |
C21-steroid |
| mass |
288.511 |
| monoisotopicmass |
288.28170 |
| notation |
CHEBI:61313 |
| prefLabel |
C21-steroid |
| smiles |
C1CCCC2C1(C3C(CC2)C4C(CC3)(C(CC4)CC)C)C |
| textual definition |
A steroid that has a structure based on a 21-carbon (pregnane) skeleton. Note that individual examples may have ring substituents at other positions and/or contain double bonds, aromatic A-rings, expanded/contracted rings etc., so the formula and mass may vary from that given for the generic structure. |
| subClassOf |