| Preferred Name |
alanine |
| Synonyms |
alanina 2-aminopropanoic acid Alanin A alanine 2-Aminopropionic acid 2-Aminopropanoic acid ALA Alanine |
| Definitions |
An alpha-amino acid that consists of propionic acid bearing an amino substituent at position 2. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_16449 |
| charge |
0 |
| database_cross_reference |
Wikipedia:Alanine Drug_Central:4306 PMID:17439666 Reaxys:635807 KEGG:C01401 Gmelin:2449 Beilstein:635807 PMID:22264337 CAS:302-72-7 |
| definition |
An alpha-amino acid that consists of propionic acid bearing an amino substituent at position 2. |
| formula |
C3H7NO2 |
| has functional parent | |
| has role | |
| has_alternative_id |
CHEBI:13748 CHEBI:22277 CHEBI:2539 |
| has_exact_synonym |
2-aminopropanoic acid alanine Alanine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
alanina Alanin A 2-Aminopropionic acid 2-Aminopropanoic acid ALA |
| id |
CHEBI:16449 |
| in_subset | |
| inchi |
InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6) |
| inchikey |
QNAYBMKLOCPYGJ-UHFFFAOYSA-N |
| is conjugate acid of | |
| is conjugate base of | |
| is tautomer of | |
| label |
alanine |
| mass |
89.09322 |
| monoisotopicmass |
89.048 |
| notation |
CHEBI:16449 |
| prefLabel |
alanine |
| smiles |
CC(N)C(O)=O |
| treeView | |
| subClassOf |